C29H38N2O6 — CID 3474216
1-[2-(dimethylamino)ethyl]-5-(3-ethoxy-4-propoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 3474216) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-5-(3-ethoxy-4-propoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 1-[2-(dimethylamino)ethyl]-5-(3-ethoxy-4-propoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3474216 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-5-(3-ethoxy-4-propoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(C(O)=C2C(=O)C(=O)N(CCN(C)C)C2c2ccc(OCCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C29H38N2O6/c1-6-17-36-22-12-9-20(10-13-22)27(32)25-26(31(16-15-30(4)5)29(34)28(25)33)21-11-14-23(37-18-7-2)24(19-21)35-8-3/h9-14,19,26,32H,6-8,15-18H2,1-5H3 |
| InChIKey | MMRWJPSTPXPLSR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|