C27H25N5O2S — CID 3474356
2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 3474356) has the molecular formula C27H25N5O2S and a molecular weight of 483.60 g/mol. Its IUPAC name is 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3474356 |
| Molecular Formula | C27H25N5O2S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25N5O2S/c1-17-18(2)28-24-14-9-19(15-23(17)24)26-30-31-27(32(26)21-7-5-4-6-8-21)35-16-25(33)29-20-10-12-22(34-3)13-11-20/h4-15,28H,16H2,1-3H3,(H,29,33) |
| InChIKey | QRWBPBCAQOSPKJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|