About 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine
2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 3474783) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine.
Molecular Properties
| Compound Name | 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine |
| PubChem CID | 3474783 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | NC(Cc1ccccc1)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C16H15N3O/c17-14(11-12-7-3-1-4-8-12)16-18-15(19-20-16)13-9-5-2-6-10-13/h1-10,14H,11,17H2 |
| InChIKey | GVHZOOKPKNWNPE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine?
The IUPAC name of 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine (CID 3474783) is 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine.
What is the SMILES notation for 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine?
The canonical SMILES for 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine is NC(Cc1ccccc1)c1nc(-c2ccccc2)no1.
What is the InChIKey of 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine?
The InChIKey is GVHZOOKPKNWNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c17-14(11-12-7-3-1-4-8-12)16-18-15(19-20-16)13-9-5-2-6-10-13/h1-10,14H,11,17H2.
What are the key properties of 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine?
2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine has a molecular weight of 265.32 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine is sourced from PubChem (CID 3474783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).