C11H20N2 — CID 3475486
3,3,7,7-tetramethylcycloheptane-1,2-diimine (PubChem CID 3475486) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 3,3,7,7-tetramethylcycloheptane-1,2-diimine.
| Compound Name | 3,3,7,7-tetramethylcycloheptane-1,2-diimine |
|---|---|
| PubChem CID | 3475486 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 3,3,7,7-tetramethylcycloheptane-1,2-diimine |
| SMILES | [H]/N=C1C(=N\[H])\C(C)(C)CCCC\1(C)C |
| InChI | InChI=1S/C11H20N2/c1-10(2)6-5-7-11(3,4)9(13)8(10)12/h12-13H,5-7H2,1-4H3/b12-8-,13-9+ |
| InChIKey | YQZLUHIVBMMFNQ-QRBCZBMESA-N |
| XLogP | 3.26 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|