C25H35FO3S — CID 3475502
(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) 4-fluorobenzenesulfonate (PubChem CID 3475502) has the molecular formula C25H35FO3S and a molecular weight of 434.62 g/mol. Its IUPAC name is (10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) 4-fluorobenzenesulfonate.
| Compound Name | (10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3475502 |
| Molecular Formula | C25H35FO3S |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) 4-fluorobenzenesulfonate |
| SMILES | CC12CCCC1C1CCC3CC(OS(=O)(=O)c4ccc(F)cc4)CCC3(C)C1CC2 |
| InChI | InChI=1S/C25H35FO3S/c1-24-13-3-4-22(24)21-10-5-17-16-19(11-15-25(17,2)23(21)12-14-24)29-30(27,28)20-8-6-18(26)7-9-20/h6-9,17,19,21-23H,3-5,10-16H2,1-2H3 |
| InChIKey | BNXIOYCVQJVXLJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|