C21H17F3N4O2 — CID 34759044
2-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 34759044) has the molecular formula C21H17F3N4O2 and a molecular weight of 414.39 g/mol. Its IUPAC name is 2-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 34759044 |
| Molecular Formula | C21H17F3N4O2 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)Nc1ccccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C21H17F3N4O2/c22-21(23,24)14-25-20(30)17-8-4-5-9-18(17)27-19(29)11-10-15-12-26-28(13-15)16-6-2-1-3-7-16/h1-13H,14H2,(H,25,30)(H,27,29)/b11-10+ |
| InChIKey | PRYOZTYOAFZDEN-ZHACJKMWSA-N |
| XLogP | 3.82 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|