C17H13F3N6O4S — CID 3476480
2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-2-nitrophenyl)acetamide (PubChem CID 3476480) has the molecular formula C17H13F3N6O4S and a molecular weight of 454.39 g/mol. Its IUPAC name is 2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-2-nitrophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3476480 |
| Molecular Formula | C17H13F3N6O4S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-2-nitrophenyl)acetamide |
| SMILES | Nn1c(SCC(=O)Nc2ccc(F)cc2[N+](=O)[O-])nnc1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N6O4S/c18-10-3-6-12(13(7-10)26(28)29)22-14(27)8-31-17-24-23-15(25(17)21)9-1-4-11(5-2-9)30-16(19)20/h1-7,16H,8,21H2,(H,22,27) |
| InChIKey | ZNAKRHXQHVNMOY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|