About 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine
1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 3476608) has the molecular formula C8H15N3OS
and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine |
| PubChem CID | 3476608 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine |
| SMILES | CCCCSc1nnc(C(C)N)o1 |
| InChI | InChI=1S/C8H15N3OS/c1-3-4-5-13-8-11-10-7(12-8)6(2)9/h6H,3-5,9H2,1-2H3 |
| InChIKey | BPCAHTGTFUQBNA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The IUPAC name of 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine (CID 3476608) is 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine.
What is the SMILES notation for 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The canonical SMILES for 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine is CCCCSc1nnc(C(C)N)o1.
What is the InChIKey of 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The InChIKey is BPCAHTGTFUQBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3OS/c1-3-4-5-13-8-11-10-7(12-8)6(2)9/h6H,3-5,9H2,1-2H3.
What are the key properties of 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine has a molecular weight of 201.29 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine is sourced from PubChem (CID 3476608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).