C24H19NO4S — CID 3477163
3-[2-(3,5-dihydroxycyclohexa-1,3-dien-1-yl)-2,3-dihydro-1,5-benzothiazepin-4-yl]chromen-2-one (PubChem CID 3477163) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-[2-(3,5-dihydroxycyclohexa-1,3-dien-1-yl)-2,3-dihydro-1,5-benzothiazepin-4-yl]chromen-2-one.
| Compound Name | 3-[2-(3,5-dihydroxycyclohexa-1,3-dien-1-yl)-2,3-dihydro-1,5-benzothiazepin-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 3477163 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3-[2-(3,5-dihydroxycyclohexa-1,3-dien-1-yl)-2,3-dihydro-1,5-benzothiazepin-4-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1C1=Nc2ccccc2SC(C2=CC(O)=CC(O)C2)C1 |
| InChI | InChI=1S/C24H19NO4S/c26-16-9-15(10-17(27)12-16)23-13-20(25-19-6-2-4-8-22(19)30-23)18-11-14-5-1-3-7-21(14)29-24(18)28/h1-9,11-12,17,23,26-27H,10,13H2 |
| InChIKey | JZEDFDQMTPCIKU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|