About N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine
N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine (PubChem CID 3477339) has the molecular formula C28H28N4O3
and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine.
Molecular Properties
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine |
| PubChem CID | 3477339 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine |
| SMILES | COc1ccc(-c2c(-c3ccccc3)nn(-c3ccccc3)c2N=CN2CCOCC2)cc1OC |
| InChI | InChI=1S/C28H28N4O3/c1-33-24-14-13-22(19-25(24)34-2)26-27(21-9-5-3-6-10-21)30-32(23-11-7-4-8-12-23)28(26)29-20-31-15-17-35-18-16-31/h3-14,19-20H,15-18H2,1-2H3 |
| InChIKey | SCLPOEWJWXPDCQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 61.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine?
The IUPAC name of N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine (CID 3477339) is N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine.
What is the SMILES notation for N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine?
The canonical SMILES for N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine is COc1ccc(-c2c(-c3ccccc3)nn(-c3ccccc3)c2N=CN2CCOCC2)cc1OC.
What is the InChIKey of N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine?
The InChIKey is SCLPOEWJWXPDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N4O3/c1-33-24-14-13-22(19-25(24)34-2)26-27(21-9-5-3-6-10-21)30-32(23-11-7-4-8-12-23)28(26)29-20-31-15-17-35-18-16-31/h3-14,19-20H,15-18H2,1-2H3.
What are the key properties of N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine?
N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine has a molecular weight of 468.56 g/mol, XLogP of 5.22, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-dimethoxyphenyl)-1,3-diphenylpyrazol-5-yl]-1-morpholin-4-ylmethanimine is sourced from PubChem (CID 3477339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).