C21H12F14N2O2 — CID 3477783
2,2,3,3,4,4,4-heptafluoro-N-[4-[[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]methyl]phenyl]butanamide (PubChem CID 3477783) has the molecular formula C21H12F14N2O2 and a molecular weight of 590.31 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[4-[[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]methyl]phenyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[4-[[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 3477783 |
| Molecular Formula | C21H12F14N2O2 |
| Molecular Weight | 590.31 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[4-[[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]methyl]phenyl]butanamide |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H12F14N2O2/c22-16(23,18(26,27)20(30,31)32)14(38)36-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)37-15(39)17(24,25)19(28,29)21(33,34)35/h1-8H,9H2,(H,36,38)(H,37,39) |
| InChIKey | FMMYORNQKAYREA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.31 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|