About N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide
N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide (PubChem CID 34779176) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide |
| PubChem CID | 34779176 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1noc(CN2CCC(C(=O)NCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H22N4O2/c1-13-19-16(23-20-13)12-21-9-7-15(8-10-21)17(22)18-11-14-5-3-2-4-6-14/h2-6,15H,7-12H2,1H3,(H,18,22) |
| InChIKey | PFBDPFJZIPKMSS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide?
The IUPAC name of N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide (CID 34779176) is N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide.
What is the SMILES notation for N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide?
The canonical SMILES for N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide is Cc1noc(CN2CCC(C(=O)NCc3ccccc3)CC2)n1.
What is the InChIKey of N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide?
The InChIKey is PFBDPFJZIPKMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-13-19-16(23-20-13)12-21-9-7-15(8-10-21)17(22)18-11-14-5-3-2-4-6-14/h2-6,15H,7-12H2,1H3,(H,18,22).
What are the key properties of N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide?
N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide has a molecular weight of 314.39 g/mol, XLogP of 1.91, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide is sourced from PubChem (CID 34779176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).