C28H57N5 — CID 3477947
N,N',N'-tris(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine (PubChem CID 3477947) has the molecular formula C28H57N5 and a molecular weight of 463.80 g/mol. Its IUPAC name is N,N',N'-tris(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine.
| Compound Name | N,N',N'-tris(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
|---|---|
| PubChem CID | 3477947 |
| Molecular Formula | C28H57N5 |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 463.46 |
| IUPAC Name | N,N',N'-tris(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
| SMILES | CC1(C)CC(NCN(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C28H57N5/c1-23(2)13-20(14-24(3,4)30-23)29-19-33(21-15-25(5,6)31-26(7,8)16-21)22-17-27(9,10)32-28(11,12)18-22/h20-22,29-32H,13-19H2,1-12H3 |
| InChIKey | GACPEGRKBIMSQN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|