About 2-ethylsulfanyl-1,3-benzothiazol-3-ium
2-ethylsulfanyl-1,3-benzothiazol-3-ium (PubChem CID 3477999) has the molecular formula C9H10NS2+
and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-ethylsulfanyl-1,3-benzothiazol-3-ium.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-1,3-benzothiazol-3-ium |
| PubChem CID | 3477999 |
| Molecular Formula | C9H10NS2+ |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 2-ethylsulfanyl-1,3-benzothiazol-3-ium |
| SMILES | CCSc1[nH+]c2ccccc2s1 |
| InChI | InChI=1S/C9H9NS2/c1-2-11-9-10-7-5-3-4-6-8(7)12-9/h3-6H,2H2,1H3/p+1 |
| InChIKey | HKIQFQKRAQSUJI-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylsulfanyl-1,3-benzothiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-1,3-benzothiazol-3-ium?
The IUPAC name of 2-ethylsulfanyl-1,3-benzothiazol-3-ium (CID 3477999) is 2-ethylsulfanyl-1,3-benzothiazol-3-ium.
What is the SMILES notation for 2-ethylsulfanyl-1,3-benzothiazol-3-ium?
The canonical SMILES for 2-ethylsulfanyl-1,3-benzothiazol-3-ium is CCSc1[nH+]c2ccccc2s1.
What is the InChIKey of 2-ethylsulfanyl-1,3-benzothiazol-3-ium?
The InChIKey is HKIQFQKRAQSUJI-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H9NS2/c1-2-11-9-10-7-5-3-4-6-8(7)12-9/h3-6H,2H2,1H3/p+1.
What are the key properties of 2-ethylsulfanyl-1,3-benzothiazol-3-ium?
2-ethylsulfanyl-1,3-benzothiazol-3-ium has a molecular weight of 196.32 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-1,3-benzothiazol-3-ium is sourced from PubChem (CID 3477999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).