C19H20Cl2N2O — CID 3478464
2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)phenyl]benzamide (PubChem CID 3478464) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3478464 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)phenyl]benzamide |
| SMILES | CC1CCN(c2ccccc2NC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O/c1-13-8-10-23(11-9-13)18-5-3-2-4-17(18)22-19(24)15-7-6-14(20)12-16(15)21/h2-7,12-13H,8-11H2,1H3,(H,22,24) |
| InChIKey | NJSAGCHIFXMZTP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |