C13H6BrF5O — CID 3478698
(4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 3478698) has the molecular formula C13H6BrF5O and a molecular weight of 353.08 g/mol. Its IUPAC name is (4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | (4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 3478698 |
| Molecular Formula | C13H6BrF5O |
| Molecular Weight | 353.08 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | (4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | OC(c1ccc(Br)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H6BrF5O/c14-6-3-1-5(2-4-6)13(20)7-8(15)10(17)12(19)11(18)9(7)16/h1-4,13,20H |
| InChIKey | QUKGWWXILDUOKH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.08 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|