About 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine
1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine (PubChem CID 3478782) has the molecular formula C19H29N5
and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine.
Molecular Properties
| Compound Name | 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine |
| PubChem CID | 3478782 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine |
| SMILES | c1ccc2c(c1)nnn2C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C19H29N5/c1-3-9-15(10-4-1)20-19(21-16-11-5-2-6-12-16)24-18-14-8-7-13-17(18)22-23-24/h7-8,13-16,19-21H,1-6,9-12H2 |
| InChIKey | DKHVVDPPWKAQGE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine?
The IUPAC name of 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine (CID 3478782) is 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine.
What is the SMILES notation for 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine?
The canonical SMILES for 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine is c1ccc2c(c1)nnn2C(NC1CCCCC1)NC1CCCCC1.
What is the InChIKey of 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine?
The InChIKey is DKHVVDPPWKAQGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N5/c1-3-9-15(10-4-1)20-19(21-16-11-5-2-6-12-16)24-18-14-8-7-13-17(18)22-23-24/h7-8,13-16,19-21H,1-6,9-12H2.
What are the key properties of 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine?
1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine has a molecular weight of 327.48 g/mol, XLogP of 3.73, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine is sourced from PubChem (CID 3478782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).