C19H29N5 — CID 3478782
1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine (PubChem CID 3478782) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine.
| Compound Name | 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine |
|---|---|
| PubChem CID | 3478782 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 1-(benzotriazol-1-yl)-N,N'-dicyclohexylmethanediamine |
| SMILES | c1ccc2c(c1)nnn2C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C19H29N5/c1-3-9-15(10-4-1)20-19(21-16-11-5-2-6-12-16)24-18-14-8-7-13-17(18)22-23-24/h7-8,13-16,19-21H,1-6,9-12H2 |
| InChIKey | DKHVVDPPWKAQGE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|