C26H28FN3O2 — CID 34790921
N-[1-[2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-4-fluorobenzamide (PubChem CID 34790921) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[1-[2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 34790921 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[1-[2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-4-fluorobenzamide |
| SMILES | CCN(C(=O)CN1CCC(NC(=O)c2ccc(F)cc2)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H28FN3O2/c1-2-30(24-9-5-7-19-6-3-4-8-23(19)24)25(31)18-29-16-14-22(15-17-29)28-26(32)20-10-12-21(27)13-11-20/h3-13,22H,2,14-18H2,1H3,(H,28,32) |
| InChIKey | YLFIMKNLBZUTGD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |