C13H9F13N4O — CID 3479566
N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 3479566) has the molecular formula C13H9F13N4O and a molecular weight of 484.22 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 3479566 |
| Molecular Formula | C13H9F13N4O |
| Molecular Weight | 484.22 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | Cc1nn(C)cc1C=NNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F13N4O/c1-5-6(4-30(2)29-5)3-27-28-7(31)8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h3-4H,1-2H3,(H,28,31) |
| InChIKey | LXNDODURWDYXQU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|