C25H33N3O3 — CID 3479718
N-[1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl]-2,2,4,6,7-pentamethylquinoline-1-carboxamide (PubChem CID 3479718) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl]-2,2,4,6,7-pentamethylquinoline-1-carboxamide.
| Compound Name | N-[1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl]-2,2,4,6,7-pentamethylquinoline-1-carboxamide |
|---|---|
| PubChem CID | 3479718 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl]-2,2,4,6,7-pentamethylquinoline-1-carboxamide |
| SMILES | CC1=CC(C)(C)N(C(=O)NC(C)N2C(=O)C3CCCCC3C2=O)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C25H33N3O3/c1-14-11-20-16(3)13-25(5,6)28(21(20)12-15(14)2)24(31)26-17(4)27-22(29)18-9-7-8-10-19(18)23(27)30/h11-13,17-19H,7-10H2,1-6H3,(H,26,31) |
| InChIKey | MLIZIWCWBQOBSO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|