C15H17N3O2S2 — CID 3480065
1-[4-(1,3-thiazol-2-ylmethyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethane-1,2-dione (PubChem CID 3480065) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[4-(1,3-thiazol-2-ylmethyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethane-1,2-dione.
| Compound Name | 1-[4-(1,3-thiazol-2-ylmethyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethane-1,2-dione |
|---|---|
| PubChem CID | 3480065 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 1-[4-(1,3-thiazol-2-ylmethyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCN(Cc2nccs2)CC1)c1cccs1 |
| InChI | InChI=1S/C15H17N3O2S2/c19-14(12-3-1-9-21-12)15(20)18-6-2-5-17(7-8-18)11-13-16-4-10-22-13/h1,3-4,9-10H,2,5-8,11H2 |
| InChIKey | AKMRNYMOPOLHTB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|