About 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine
2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 3480101) has the molecular formula C21H17N5S
and a molecular weight of 371.47 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 3480101 |
| Molecular Formula | C21H17N5S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccc(C)n1-c1ccsc1-c1cc2nccc(-c3cccnc3)n2n1 |
| InChI | InChI=1S/C21H17N5S/c1-14-5-6-15(2)25(14)19-8-11-27-21(19)17-12-20-23-10-7-18(26(20)24-17)16-4-3-9-22-13-16/h3-13H,1-2H3 |
| InChIKey | KTSJOVIHINMHHI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine (CID 3480101) is 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine is Cc1ccc(C)n1-c1ccsc1-c1cc2nccc(-c3cccnc3)n2n1.
What is the InChIKey of 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine?
The InChIKey is KTSJOVIHINMHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5S/c1-14-5-6-15(2)25(14)19-8-11-27-21(19)17-12-20-23-10-7-18(26(20)24-17)16-4-3-9-22-13-16/h3-13H,1-2H3.
What are the key properties of 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine?
2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine has a molecular weight of 371.47 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-7-pyridin-3-ylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 3480101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).