About (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate
(5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate (PubChem CID 34808901) has the molecular formula C23H18ClNO4
and a molecular weight of 407.85 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate.
Molecular Properties
| Compound Name | (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate |
| PubChem CID | 34808901 |
| Molecular Formula | C23H18ClNO4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate |
| SMILES | Cc1ccc2c(C)c(CCC(=O)Oc3ccc(Cl)c4cccnc34)c(=O)oc2c1 |
| InChI | InChI=1S/C23H18ClNO4/c1-13-5-6-15-14(2)16(23(27)29-20(15)12-13)7-10-21(26)28-19-9-8-18(24)17-4-3-11-25-22(17)19/h3-6,8-9,11-12H,7,10H2,1-2H3 |
| InChIKey | BDJFSRDASOOOPS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate?
The IUPAC name of (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate (CID 34808901) is (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate.
What is the SMILES notation for (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate?
The canonical SMILES for (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate is Cc1ccc2c(C)c(CCC(=O)Oc3ccc(Cl)c4cccnc34)c(=O)oc2c1.
What is the InChIKey of (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate?
The InChIKey is BDJFSRDASOOOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClNO4/c1-13-5-6-15-14(2)16(23(27)29-20(15)12-13)7-10-21(26)28-19-9-8-18(24)17-4-3-11-25-22(17)19/h3-6,8-9,11-12H,7,10H2,1-2H3.
What are the key properties of (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate?
(5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate has a molecular weight of 407.85 g/mol, XLogP of 5.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloroquinolin-8-yl) 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate is sourced from PubChem (CID 34808901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).