C22H15ClN4O2 — CID 3481048
1-(4-chlorophenyl)-6-imino-8-methyl-3-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3481048) has the molecular formula C22H15ClN4O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-imino-8-methyl-3-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(4-chlorophenyl)-6-imino-8-methyl-3-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3481048 |
| Molecular Formula | C22H15ClN4O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1-(4-chlorophenyl)-6-imino-8-methyl-3-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Cl)cc3)OC(c3ccccc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C22H15ClN4O2/c1-14-21(13-26)19(27)29-22(14,16-7-9-17(23)10-8-16)28-18(20(21,11-24)12-25)15-5-3-2-4-6-15/h2-10,14,18,27H,1H3/b27-19- |
| InChIKey | IAMMMFZFILCQAI-DIBXZPPDSA-N |
| XLogP | 4.45 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|