C10H16N10O — CID 3481315
6-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 3481315) has the molecular formula C10H16N10O and a molecular weight of 292.31 g/mol. Its IUPAC name is 6-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3481315 |
| Molecular Formula | C10H16N10O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(CCOCCc2nc(N)nc(N)n2)n1 |
| InChI | InChI=1S/C10H16N10O/c11-7-15-5(16-8(12)19-7)1-3-21-4-2-6-17-9(13)20-10(14)18-6/h1-4H2,(H4,11,12,15,16,19)(H4,13,14,17,18,20) |
| InChIKey | LWDVUOCVNIKQBJ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|