About [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate
[3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate (PubChem CID 3481451) has the molecular formula C12H16ClNO3
and a molecular weight of 257.72 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate |
| PubChem CID | 3481451 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate |
| SMILES | CC(C)(COC(N)=O)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO3/c1-12(2,7-17-11(14)16)10(15)8-3-5-9(13)6-4-8/h3-6,10,15H,7H2,1-2H3,(H2,14,16) |
| InChIKey | VPINAMCGEJTXAA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate?
The IUPAC name of [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate (CID 3481451) is [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate.
What is the SMILES notation for [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate?
The canonical SMILES for [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate is CC(C)(COC(N)=O)C(O)c1ccc(Cl)cc1.
What is the InChIKey of [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate?
The InChIKey is VPINAMCGEJTXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO3/c1-12(2,7-17-11(14)16)10(15)8-3-5-9(13)6-4-8/h3-6,10,15H,7H2,1-2H3,(H2,14,16).
What are the key properties of [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate?
[3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate has a molecular weight of 257.72 g/mol, XLogP of 2.49, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-3-hydroxy-2,2-dimethylpropyl] carbamate is sourced from PubChem (CID 3481451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).