About 5-prop-2-enyl-1,3,5-triazinane-2-thione
5-prop-2-enyl-1,3,5-triazinane-2-thione (PubChem CID 3481912) has the molecular formula C6H11N3S
and a molecular weight of 157.24 g/mol. Its IUPAC name is 5-prop-2-enyl-1,3,5-triazinane-2-thione.
Molecular Properties
| Compound Name | 5-prop-2-enyl-1,3,5-triazinane-2-thione |
| PubChem CID | 3481912 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-prop-2-enyl-1,3,5-triazinane-2-thione |
| SMILES | C=CCN1CNC(=S)NC1 |
| InChI | InChI=1S/C6H11N3S/c1-2-3-9-4-7-6(10)8-5-9/h2H,1,3-5H2,(H2,7,8,10) |
| InChIKey | WQMKJISFMDDGOX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enyl-1,3,5-triazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enyl-1,3,5-triazinane-2-thione?
The IUPAC name of 5-prop-2-enyl-1,3,5-triazinane-2-thione (CID 3481912) is 5-prop-2-enyl-1,3,5-triazinane-2-thione.
What is the SMILES notation for 5-prop-2-enyl-1,3,5-triazinane-2-thione?
The canonical SMILES for 5-prop-2-enyl-1,3,5-triazinane-2-thione is C=CCN1CNC(=S)NC1.
What is the InChIKey of 5-prop-2-enyl-1,3,5-triazinane-2-thione?
The InChIKey is WQMKJISFMDDGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3S/c1-2-3-9-4-7-6(10)8-5-9/h2H,1,3-5H2,(H2,7,8,10).
What are the key properties of 5-prop-2-enyl-1,3,5-triazinane-2-thione?
5-prop-2-enyl-1,3,5-triazinane-2-thione has a molecular weight of 157.24 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enyl-1,3,5-triazinane-2-thione is sourced from PubChem (CID 3481912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).