C25H16BrClN2O4S — CID 3482126
5-(3-bromophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3482126) has the molecular formula C25H16BrClN2O4S and a molecular weight of 555.84 g/mol. Its IUPAC name is 5-(3-bromophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3482126 |
| Molecular Formula | C25H16BrClN2O4S |
| Molecular Weight | 555.84 g/mol |
| Exact Mass | 553.97 |
| IUPAC Name | 5-(3-bromophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)C(=C(O)c4ccc(Cl)cc4)C3c3cccc(Br)c3)sc2c1 |
| InChI | InChI=1S/C25H16BrClN2O4S/c1-33-17-9-10-18-19(12-17)34-25(28-18)29-21(14-3-2-4-15(26)11-14)20(23(31)24(29)32)22(30)13-5-7-16(27)8-6-13/h2-12,21,30H,1H3 |
| InChIKey | ONOGOGKPMIJYFT-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.84 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|