C26H30N5O3S+ — CID 3482282
1-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)benzoyl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide (PubChem CID 3482282) has the molecular formula C26H30N5O3S+ and a molecular weight of 492.63 g/mol. Its IUPAC name is 1-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)benzoyl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)benzoyl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3482282 |
| Molecular Formula | C26H30N5O3S+ |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 1-[4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)benzoyl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1([NH+]2CCCCC2)CCN(C(=O)c2ccc(-n3c(=S)[nH]c4ccccc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C26H29N5O3S/c27-24(34)26(30-14-4-1-5-15-30)12-16-29(17-13-26)22(32)18-8-10-19(11-9-18)31-23(33)20-6-2-3-7-21(20)28-25(31)35/h2-3,6-11H,1,4-5,12-17H2,(H2,27,34)(H,28,35)/p+1 |
| InChIKey | UIKVEQYIVXEGKB-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|