4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid

C12H7NO3S — CID 3482993

IUPAC4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid
SMILESO=C(O)c1cc2c(=O)[nH]c3ccccc3c2s1
InChIInChI=1S/C12H7NO3S/c14-11-7-5-9(12(15)16)17-10(7)6-3-1-2-4-8(6)13-11/h1-5H,(H,13,14)(H,15,16)
InChIKeyHJIXEBZEMFGCFM-UHFFFAOYSA-N
MW245.26 g/mol
LogP2.44
Rot. Bonds1

About 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid

4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid (PubChem CID 3482993) has the molecular formula C12H7NO3S and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid.

Molecular Properties

Compound Name4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid
PubChem CID3482993
Molecular FormulaC12H7NO3S
Molecular Weight245.26 g/mol
Exact Mass245.01
IUPAC Name4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid
SMILESO=C(O)c1cc2c(=O)[nH]c3ccccc3c2s1
InChIInChI=1S/C12H7NO3S/c14-11-7-5-9(12(15)16)17-10(7)6-3-1-2-4-8(6)13-11/h1-5H,(H,13,14)(H,15,16)
InChIKeyHJIXEBZEMFGCFM-UHFFFAOYSA-N
XLogP2.44
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.26
LogP ≤ 52.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid?
The IUPAC name of 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid (CID 3482993) is 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid.
What is the SMILES notation for 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid?
The canonical SMILES for 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid is O=C(O)c1cc2c(=O)[nH]c3ccccc3c2s1.
What is the InChIKey of 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid?
The InChIKey is HJIXEBZEMFGCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO3S/c14-11-7-5-9(12(15)16)17-10(7)6-3-1-2-4-8(6)13-11/h1-5H,(H,13,14)(H,15,16).
What are the key properties of 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid?
4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid has a molecular weight of 245.26 g/mol, XLogP of 2.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylic acid is sourced from PubChem (CID 3482993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).