C35H28ClN3O3S2 — CID 3483614
5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3483614) has the molecular formula C35H28ClN3O3S2 and a molecular weight of 638.21 g/mol. Its IUPAC name is 5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3483614 |
| Molecular Formula | C35H28ClN3O3S2 |
| Molecular Weight | 638.21 g/mol |
| Exact Mass | 637.13 |
| IUPAC Name | 5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CCN2C(=O)C(=Cc3cn(-c4ccccc4)nc3-c3ccc(OCc4ccccc4Cl)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C35H28ClN3O3S2/c1-41-29-15-11-24(12-16-29)19-20-38-34(40)32(44-35(38)43)21-27-22-39(28-8-3-2-4-9-28)37-33(27)25-13-17-30(18-14-25)42-23-26-7-5-6-10-31(26)36/h2-18,21-22H,19-20,23H2,1H3 |
| InChIKey | LZSLTNCZUNOTJW-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.21 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|