C18H18ClN3O2 — CID 34838039
1-(3-chlorophenyl)-N,N-diethyl-5-(furan-2-yl)pyrazole-3-carboxamide (PubChem CID 34838039) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N,N-diethyl-5-(furan-2-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N,N-diethyl-5-(furan-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 34838039 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N,N-diethyl-5-(furan-2-yl)pyrazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(-c2ccco2)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-3-21(4-2)18(23)15-12-16(17-9-6-10-24-17)22(20-15)14-8-5-7-13(19)11-14/h5-12H,3-4H2,1-2H3 |
| InChIKey | RAKMOJQEANPDRE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |