About 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone
1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone (PubChem CID 34839065) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone.
Molecular Properties
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone |
| PubChem CID | 34839065 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone |
| SMILES | CC(=O)N1CCN(C(=O)Cc2cn3ccsc3n2)CC1 |
| InChI | InChI=1S/C13H16N4O2S/c1-10(18)15-2-4-16(5-3-15)12(19)8-11-9-17-6-7-20-13(17)14-11/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | MCZIUNVEEKPQEG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone?
The IUPAC name of 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone (CID 34839065) is 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone.
What is the SMILES notation for 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone?
The canonical SMILES for 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone is CC(=O)N1CCN(C(=O)Cc2cn3ccsc3n2)CC1.
What is the InChIKey of 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone?
The InChIKey is MCZIUNVEEKPQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-10(18)15-2-4-16(5-3-15)12(19)8-11-9-17-6-7-20-13(17)14-11/h6-7,9H,2-5,8H2,1H3.
What are the key properties of 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone?
1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone has a molecular weight of 292.36 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone is sourced from PubChem (CID 34839065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).