About 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide
4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 3484025) has the molecular formula C15H16N2OS
and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| PubChem CID | 3484025 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | CC1c2ccsc2CCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H16N2OS/c1-11-13-8-10-19-14(13)7-9-17(11)15(18)16-12-5-3-2-4-6-12/h2-6,8,10-11H,7,9H2,1H3,(H,16,18) |
| InChIKey | ZGDJKBIGXVLSEZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
The IUPAC name of 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (CID 3484025) is 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
What is the SMILES notation for 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
The canonical SMILES for 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide is CC1c2ccsc2CCN1C(=O)Nc1ccccc1.
What is the InChIKey of 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
The InChIKey is ZGDJKBIGXVLSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2OS/c1-11-13-8-10-19-14(13)7-9-17(11)15(18)16-12-5-3-2-4-6-12/h2-6,8,10-11H,7,9H2,1H3,(H,16,18).
What are the key properties of 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide has a molecular weight of 272.37 g/mol, XLogP of 3.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide is sourced from PubChem (CID 3484025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).