C41H49F3N2O5 — CID 3484056
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea (PubChem CID 3484056) has the molecular formula C41H49F3N2O5 and a molecular weight of 706.85 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
|---|---|
| PubChem CID | 3484056 |
| Molecular Formula | C41H49F3N2O5 |
| Molecular Weight | 706.85 g/mol |
| Exact Mass | 706.36 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
| SMILES | COCCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC5(C)C4CCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C41H49F3N2O5/c1-36-16-13-30(47)24-38(36)19-20-40(31(25-38)34(48)27-9-7-10-28(23-27)41(42,43)44)32(36)14-17-37(2)33(40)15-18-39(37,50)26-46(21-8-22-51-3)35(49)45-29-11-5-4-6-12-29/h4-7,9-12,19-20,23,25,30,32-33,47,50H,8,13-18,21-22,24,26H2,1-3H3,(H,45,49) |
| InChIKey | NSMSJNDYZUWTOA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.85 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|