C6F12 — CID 3484542
1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene (PubChem CID 3484542) has the molecular formula C6F12 and a molecular weight of 300.04 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 3484542 |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.04 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene |
| SMILES | FC(=C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F12/c7-1(2(8)4(10,11)12)3(9,5(13,14)15)6(16,17)18 |
| InChIKey | SAPOZTRFWJZUFT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.04 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |