C22H36ClN3S — CID 3484571
1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 3484571) has the molecular formula C22H36ClN3S and a molecular weight of 410.07 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 3484571 |
| Molecular Formula | C22H36ClN3S |
| Molecular Weight | 410.07 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CN1CCC(N(Cc2ccccc2Cl)C(=S)NC(C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H36ClN3S/c1-21(2,3)16-22(4,5)24-20(27)26(18-11-13-25(6)14-12-18)15-17-9-7-8-10-19(17)23/h7-10,18H,11-16H2,1-6H3,(H,24,27) |
| InChIKey | KGNAMUMUMXZENF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.07 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|