C18H16ClN3O — CID 34846987
4-chloro-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]benzamide (PubChem CID 34846987) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is 4-chloro-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 34846987 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-chloro-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]benzamide |
| SMILES | Cc1cc(C)n(-c2ccc(NC(=O)c3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C18H16ClN3O/c1-12-11-13(2)22(21-12)17-9-7-16(8-10-17)20-18(23)14-3-5-15(19)6-4-14/h3-11H,1-2H3,(H,20,23) |
| InChIKey | DSBGGVRLZHNNJW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |