About N,N'-ditert-butyl-3,3-dimethylbutanimidamide
N,N'-ditert-butyl-3,3-dimethylbutanimidamide (PubChem CID 3485310) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N,N'-ditert-butyl-3,3-dimethylbutanimidamide.
Molecular Properties
| Compound Name | N,N'-ditert-butyl-3,3-dimethylbutanimidamide |
| PubChem CID | 3485310 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N,N'-ditert-butyl-3,3-dimethylbutanimidamide |
| SMILES | CC(C)(C)C/C(=N\C(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C14H30N2/c1-12(2,3)10-11(15-13(4,5)6)16-14(7,8)9/h10H2,1-9H3,(H,15,16) |
| InChIKey | LLVKNPMHAOENMY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-ditert-butyl-3,3-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-ditert-butyl-3,3-dimethylbutanimidamide?
The IUPAC name of N,N'-ditert-butyl-3,3-dimethylbutanimidamide (CID 3485310) is N,N'-ditert-butyl-3,3-dimethylbutanimidamide.
What is the SMILES notation for N,N'-ditert-butyl-3,3-dimethylbutanimidamide?
The canonical SMILES for N,N'-ditert-butyl-3,3-dimethylbutanimidamide is CC(C)(C)C/C(=N\C(C)(C)C)NC(C)(C)C.
What is the InChIKey of N,N'-ditert-butyl-3,3-dimethylbutanimidamide?
The InChIKey is LLVKNPMHAOENMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2/c1-12(2,3)10-11(15-13(4,5)6)16-14(7,8)9/h10H2,1-9H3,(H,15,16).
What are the key properties of N,N'-ditert-butyl-3,3-dimethylbutanimidamide?
N,N'-ditert-butyl-3,3-dimethylbutanimidamide has a molecular weight of 226.41 g/mol, XLogP of 4.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-ditert-butyl-3,3-dimethylbutanimidamide is sourced from PubChem (CID 3485310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).