C18H23F2N5O2S2 — CID 34856747
2-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione (PubChem CID 34856747) has the molecular formula C18H23F2N5O2S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione.
| Compound Name | 2-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
|---|---|
| PubChem CID | 34856747 |
| Molecular Formula | C18H23F2N5O2S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-thione |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(Cn2nc3n(c2=S)CCCCC3)CC1 |
| InChI | InChI=1S/C18H23F2N5O2S2/c19-14-5-4-6-15(20)17(14)29(26,27)23-11-9-22(10-12-23)13-25-18(28)24-8-3-1-2-7-16(24)21-25/h4-6H,1-3,7-13H2 |
| InChIKey | PQDQQIMOEAUBTH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|