About 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one
7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one (PubChem CID 3485810) has the molecular formula C16H11N3O4
and a molecular weight of 309.28 g/mol. Its IUPAC name is 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one.
Molecular Properties
| Compound Name | 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
| PubChem CID | 3485810 |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
| SMILES | O=C1C2=C(Nc3cc([N+](=O)[O-])ccc3N2)OC1c1ccccc1 |
| InChI | InChI=1S/C16H11N3O4/c20-14-13-16(23-15(14)9-4-2-1-3-5-9)18-12-8-10(19(21)22)6-7-11(12)17-13/h1-8,15,17-18H |
| InChIKey | DXPLUAXYUCCUAN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
The IUPAC name of 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one (CID 3485810) is 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one.
What is the SMILES notation for 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
The canonical SMILES for 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one is O=C1C2=C(Nc3cc([N+](=O)[O-])ccc3N2)OC1c1ccccc1.
What is the InChIKey of 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
The InChIKey is DXPLUAXYUCCUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O4/c20-14-13-16(23-15(14)9-4-2-1-3-5-9)18-12-8-10(19(21)22)6-7-11(12)17-13/h1-8,15,17-18H.
What are the key properties of 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one has a molecular weight of 309.28 g/mol, XLogP of 2.94, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-2-phenyl-4,9-dihydrofuro[3,2-b]quinoxalin-3-one is sourced from PubChem (CID 3485810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).