C22H22O4 — CID 3485889
diethyl tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,15-dicarboxylate (PubChem CID 3485889) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is diethyl tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,15-dicarboxylate.
| Compound Name | diethyl tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,15-dicarboxylate |
|---|---|
| PubChem CID | 3485889 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | diethyl tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,15-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C22H22O4/c1-3-25-20(23)22(21(24)26-4-2)13-18-14-9-5-7-11-16(14)19(22)17-12-8-6-10-15(17)18/h5-12,18-19H,3-4,13H2,1-2H3 |
| InChIKey | YWOSXUDEAJOMAE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|