About trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate
trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate (PubChem CID 3485935) has the molecular formula C18H43O6PSi4
and a molecular weight of 498.85 g/mol. Its IUPAC name is trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate.
Molecular Properties
| Compound Name | trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate |
| PubChem CID | 3485935 |
| Molecular Formula | C18H43O6PSi4 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate |
| SMILES | C[Si](C)(C)OC(=O)CCP(=O)(CC=C(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H43O6PSi4/c1-26(2,3)21-17(19)13-15-25(20,24-29(10,11)12)16-14-18(22-27(4,5)6)23-28(7,8)9/h14H,13,15-16H2,1-12H3 |
| InChIKey | SXUOSBWKNXKNHG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate?
The IUPAC name of trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate (CID 3485935) is trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate.
What is the SMILES notation for trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate?
The canonical SMILES for trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate is C[Si](C)(C)OC(=O)CCP(=O)(CC=C(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate?
The InChIKey is SXUOSBWKNXKNHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H43O6PSi4/c1-26(2,3)21-17(19)13-15-25(20,24-29(10,11)12)16-14-18(22-27(4,5)6)23-28(7,8)9/h14H,13,15-16H2,1-12H3.
What are the key properties of trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate?
trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate has a molecular weight of 498.85 g/mol, XLogP of 6.43, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 3-[3,3-bis(trimethylsilyloxy)prop-2-enyl-trimethylsilyloxyphosphoryl]propanoate is sourced from PubChem (CID 3485935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).