C14H9F13N2O3S — CID 3486369
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(4-sulfamoylphenyl)methyl]heptanamide (PubChem CID 3486369) has the molecular formula C14H9F13N2O3S and a molecular weight of 532.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(4-sulfamoylphenyl)methyl]heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(4-sulfamoylphenyl)methyl]heptanamide |
|---|---|
| PubChem CID | 3486369 |
| Molecular Formula | C14H9F13N2O3S |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 532.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(4-sulfamoylphenyl)methyl]heptanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H9F13N2O3S/c15-9(16,8(30)29-5-6-1-3-7(4-2-6)33(28,31)32)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h1-4H,5H2,(H,29,30)(H2,28,31,32) |
| InChIKey | CWSCAZHIVRUESE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|