C21H17ClN2O6 — CID 3487088
4-chloro-3-[5-[[(3,5-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 3487088) has the molecular formula C21H17ClN2O6 and a molecular weight of 428.83 g/mol. Its IUPAC name is 4-chloro-3-[5-[[(3,5-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[[(3,5-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3487088 |
| Molecular Formula | C21H17ClN2O6 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-chloro-3-[5-[[(3,5-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COc1cc(OC)cc(C(=O)NN=Cc2ccc(-c3cc(C(=O)O)ccc3Cl)o2)c1 |
| InChI | InChI=1S/C21H17ClN2O6/c1-28-15-7-13(8-16(10-15)29-2)20(25)24-23-11-14-4-6-19(30-14)17-9-12(21(26)27)3-5-18(17)22/h3-11H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | DDARPTAJETYVNL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|