C20H28N4O2S — CID 34872704
N-[(2R)-1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 34872704) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is N-[(2R)-1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[(2R)-1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 34872704 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[(2R)-1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C20H28N4O2S/c1-15-14-16(2)24(23-15)12-7-11-21-20(26)18(10-13-27-3)22-19(25)17-8-5-4-6-9-17/h4-6,8-9,14,18H,7,10-13H2,1-3H3,(H,21,26)(H,22,25)/t18-/m1/s1 |
| InChIKey | OCYTVMJKSCMJDS-GOSISDBHSA-N |
| XLogP | 2.56 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|