C24H29N3O5 — CID 34874597
N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide (PubChem CID 34874597) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide.
| Compound Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 34874597 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide |
| SMILES | CCNC(=O)COc1cccc(NC(=O)C2CCN(C(=O)COc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-2-25-22(28)16-31-21-10-6-7-19(15-21)26-24(30)18-11-13-27(14-12-18)23(29)17-32-20-8-4-3-5-9-20/h3-10,15,18H,2,11-14,16-17H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | XJUKYSHUQXBRNF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |