About 5-(diethylamino)-1H-pyrimidine-2,4-dione
5-(diethylamino)-1H-pyrimidine-2,4-dione (PubChem CID 3487741) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-(diethylamino)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(diethylamino)-1H-pyrimidine-2,4-dione |
| PubChem CID | 3487741 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 5-(diethylamino)-1H-pyrimidine-2,4-dione |
| SMILES | CCN(CC)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O2/c1-3-11(4-2)6-5-9-8(13)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12,13) |
| InChIKey | QJNAQOWKHVJJHZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(diethylamino)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylamino)-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-(diethylamino)-1H-pyrimidine-2,4-dione (CID 3487741) is 5-(diethylamino)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-(diethylamino)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-(diethylamino)-1H-pyrimidine-2,4-dione is CCN(CC)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 5-(diethylamino)-1H-pyrimidine-2,4-dione?
The InChIKey is QJNAQOWKHVJJHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-3-11(4-2)6-5-9-8(13)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12,13).
What are the key properties of 5-(diethylamino)-1H-pyrimidine-2,4-dione?
5-(diethylamino)-1H-pyrimidine-2,4-dione has a molecular weight of 183.21 g/mol, XLogP of -0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylamino)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3487741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).