About N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine
N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine (PubChem CID 34883094) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine.
Molecular Properties
| Compound Name | N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine |
| PubChem CID | 34883094 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine |
| SMILES | c1ccc(NC2=NCCOC2)cc1 |
| InChI | InChI=1S/C10H12N2O/c1-2-4-9(5-3-1)12-10-8-13-7-6-11-10/h1-5H,6-8H2,(H,11,12) |
| InChIKey | HIWOBQGNLWOYBB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine?
The IUPAC name of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine (CID 34883094) is N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine.
What is the SMILES notation for N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine?
The canonical SMILES for N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine is c1ccc(NC2=NCCOC2)cc1.
What is the InChIKey of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine?
The InChIKey is HIWOBQGNLWOYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-2-4-9(5-3-1)12-10-8-13-7-6-11-10/h1-5H,6-8H2,(H,11,12).
What are the key properties of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine?
N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine has a molecular weight of 176.22 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine is sourced from PubChem (CID 34883094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).