C9H15ClN6O2 — CID 34883155
N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-2-chloroacetohydrazide (PubChem CID 34883155) has the molecular formula C9H15ClN6O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-2-chloroacetohydrazide.
| Compound Name | N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-2-chloroacetohydrazide |
|---|---|
| PubChem CID | 34883155 |
| Molecular Formula | C9H15ClN6O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-2-chloroacetohydrazide |
| SMILES | CC(C)(C)c1nnc(NNC(=O)CCl)n(N)c1=O |
| InChI | InChI=1S/C9H15ClN6O2/c1-9(2,3)6-7(18)16(11)8(15-13-6)14-12-5(17)4-10/h4,11H2,1-3H3,(H,12,17)(H,14,15) |
| InChIKey | ACUYSXOWNFMHAO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|